C11H19F6NO3S — CID 163605855
N,N-diethyl-3-(1,1,2,2,3,3-hexafluorobutylsulfonyl)propan-1-amine oxide (PubChem CID 163605855) has the molecular formula C11H19F6NO3S and a molecular weight of 359.33 g/mol. Its IUPAC name is N,N-diethyl-3-(1,1,2,2,3,3-hexafluorobutylsulfonyl)propan-1-amine oxide.
| Compound Name | N,N-diethyl-3-(1,1,2,2,3,3-hexafluorobutylsulfonyl)propan-1-amine oxide |
|---|---|
| PubChem CID | 163605855 |
| Molecular Formula | C11H19F6NO3S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N,N-diethyl-3-(1,1,2,2,3,3-hexafluorobutylsulfonyl)propan-1-amine oxide |
| SMILES | CC[N+]([O-])(CC)CCCS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C11H19F6NO3S/c1-4-18(19,5-2)7-6-8-22(20,21)11(16,17)10(14,15)9(3,12)13/h4-8H2,1-3H3 |
| InChIKey | OGCCUHKUXUXPGX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|