C16H22F13NO2S — CID 101424707
N-butyl-N-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)ethyl]butan-1-amine (PubChem CID 101424707) has the molecular formula C16H22F13NO2S and a molecular weight of 539.40 g/mol. Its IUPAC name is N-butyl-N-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)ethyl]butan-1-amine.
| Compound Name | N-butyl-N-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 101424707 |
| Molecular Formula | C16H22F13NO2S |
| Molecular Weight | 539.40 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | N-butyl-N-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)ethyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H22F13NO2S/c1-3-5-7-30(8-6-4-2)9-10-33(31,32)16(28,29)14(23,24)12(19,20)11(17,18)13(21,22)15(25,26)27/h3-10H2,1-2H3 |
| InChIKey | SQYJTRZIWPONMW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.40 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|