C14H23F10NO3S2 — CID 91451103
2-[2-(2-fluoroethylsulfanyl)ethyl-dimethylazaniumyl]ethanesulfonate;1,1,2,2,3,3,4,4,5-nonafluorohexane (PubChem CID 91451103) has the molecular formula C14H23F10NO3S2 and a molecular weight of 507.46 g/mol. Its IUPAC name is 2-[2-(2-fluoroethylsulfanyl)ethyl-dimethylazaniumyl]ethanesulfonate;1,1,2,2,3,3,4,4,5-nonafluorohexane.
| Compound Name | 2-[2-(2-fluoroethylsulfanyl)ethyl-dimethylazaniumyl]ethanesulfonate;1,1,2,2,3,3,4,4,5-nonafluorohexane |
|---|---|
| PubChem CID | 91451103 |
| Molecular Formula | C14H23F10NO3S2 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-[2-(2-fluoroethylsulfanyl)ethyl-dimethylazaniumyl]ethanesulfonate;1,1,2,2,3,3,4,4,5-nonafluorohexane |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.C[N+](C)(CCSCCF)CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H18FNO3S2.C6H5F9/c1-10(2,4-7-14-6-3-9)5-8-15(11,12)13;1-2(7)4(10,11)6(14,15)5(12,13)3(8)9/h3-8H2,1-2H3;2-3H,1H3 |
| InChIKey | DUNIBCRVJOMLFF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|