C12H20F7NO2S — CID 123928450
N,N-dimethyl-4-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylbutan-1-amine (PubChem CID 123928450) has the molecular formula C12H20F7NO2S and a molecular weight of 375.35 g/mol. Its IUPAC name is N,N-dimethyl-4-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylbutan-1-amine.
| Compound Name | N,N-dimethyl-4-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylbutan-1-amine |
|---|---|
| PubChem CID | 123928450 |
| Molecular Formula | C12H20F7NO2S |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N,N-dimethyl-4-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylbutan-1-amine |
| SMILES | CN(C)CCCCS(=O)(=O)CCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H20F7NO2S/c1-20(2)7-3-4-8-23(21,22)9-5-6-10(13,11(14,15)16)12(17,18)19/h3-9H2,1-2H3 |
| InChIKey | JLUBVSZNCDYFHI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|