C17H29F9NO2S+ — CID 58419057
4-[5,5,7,8,8,8-hexafluoro-7-methyl-3-(trifluoromethyl)octyl]sulfonylbutyl-trimethylazanium (PubChem CID 58419057) has the molecular formula C17H29F9NO2S+ and a molecular weight of 482.47 g/mol. Its IUPAC name is 4-[5,5,7,8,8,8-hexafluoro-7-methyl-3-(trifluoromethyl)octyl]sulfonylbutyl-trimethylazanium.
| Compound Name | 4-[5,5,7,8,8,8-hexafluoro-7-methyl-3-(trifluoromethyl)octyl]sulfonylbutyl-trimethylazanium |
|---|---|
| PubChem CID | 58419057 |
| Molecular Formula | C17H29F9NO2S+ |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 4-[5,5,7,8,8,8-hexafluoro-7-methyl-3-(trifluoromethyl)octyl]sulfonylbutyl-trimethylazanium |
| SMILES | CC(F)(CC(F)(F)CC(CCS(=O)(=O)CCCC[N+](C)(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H29F9NO2S/c1-14(18,17(24,25)26)12-15(19,20)11-13(16(21,22)23)7-10-30(28,29)9-6-5-8-27(2,3)4/h13H,5-12H2,1-4H3/q+1 |
| InChIKey | OBZHVAUTGKANOF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|