C16H25F9NO2S+ — CID 58419043
4-[5,5,7,8,8,8-hexafluoro-7-methyl-3-(trifluoromethyl)octyl]sulfonyl-N,N-dimethylbutan-1-amine (PubChem CID 58419043) has the molecular formula C16H25F9NO2S+ and a molecular weight of 466.43 g/mol. Its IUPAC name is 4-[5,5,7,8,8,8-hexafluoro-7-methyl-3-(trifluoromethyl)octyl]sulfonyl-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[5,5,7,8,8,8-hexafluoro-7-methyl-3-(trifluoromethyl)octyl]sulfonyl-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 58419043 |
| Molecular Formula | C16H25F9NO2S+ |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 4-[5,5,7,8,8,8-hexafluoro-7-methyl-3-(trifluoromethyl)octyl]sulfonyl-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)C[CH+]CCS(=O)(=O)CCC(CC(F)(F)CC(C)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H25F9NO2S/c1-13(17,16(23,24)25)11-14(18,19)10-12(15(20,21)22)6-9-29(27,28)8-5-4-7-26(2)3/h4,12H,5-11H2,1-3H3/q+1 |
| InChIKey | XLMFHEMQEBLSGY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|