C17H32F6NO2S+ — CID 58419041
trimethyl-[3-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylpropyl]azanium (PubChem CID 58419041) has the molecular formula C17H32F6NO2S+ and a molecular weight of 428.50 g/mol. Its IUPAC name is trimethyl-[3-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylpropyl]azanium.
| Compound Name | trimethyl-[3-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylpropyl]azanium |
|---|---|
| PubChem CID | 58419041 |
| Molecular Formula | C17H32F6NO2S+ |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | trimethyl-[3-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylpropyl]azanium |
| SMILES | CC(C)(CC(CCCCS(=O)(=O)CCC[N+](C)(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H32F6NO2S/c1-15(2,17(21,22)23)13-14(16(18,19)20)9-6-7-11-27(25,26)12-8-10-24(3,4)5/h14H,6-13H2,1-5H3/q+1 |
| InChIKey | FCDFQSFGBLMELQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|