C18H34ClF6NO2S — CID 159485705
trimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-3-(trifluoromethyl)octyl]sulfonylbutyl]azanium chloride (PubChem CID 159485705) has the molecular formula C18H34ClF6NO2S and a molecular weight of 477.98 g/mol. Its IUPAC name is trimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-3-(trifluoromethyl)octyl]sulfonylbutyl]azanium chloride.
| Compound Name | trimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-3-(trifluoromethyl)octyl]sulfonylbutyl]azanium chloride |
|---|---|
| PubChem CID | 159485705 |
| Molecular Formula | C18H34ClF6NO2S |
| Molecular Weight | 477.98 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | trimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-3-(trifluoromethyl)octyl]sulfonylbutyl]azanium chloride |
| SMILES | CC(C)(CCCC(CCS(=O)(=O)CCCC[N+](C)(C)C)C(F)(F)F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C18H34F6NO2S.ClH/c1-16(2,18(22,23)24)11-8-9-15(17(19,20)21)10-14-28(26,27)13-7-6-12-25(3,4)5;/h15H,6-14H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | KEHTWJOTPIKHDC-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.98 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|