C15H26F7NO2S — CID 123537470
N,N-dimethyl-4-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octyl]sulfonylbutan-1-amine (PubChem CID 123537470) has the molecular formula C15H26F7NO2S and a molecular weight of 417.43 g/mol. Its IUPAC name is N,N-dimethyl-4-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octyl]sulfonylbutan-1-amine.
| Compound Name | N,N-dimethyl-4-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octyl]sulfonylbutan-1-amine |
|---|---|
| PubChem CID | 123537470 |
| Molecular Formula | C15H26F7NO2S |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N,N-dimethyl-4-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octyl]sulfonylbutan-1-amine |
| SMILES | CN(C)CCCCS(=O)(=O)CCCCCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H26F7NO2S/c1-23(2)10-6-8-12-26(24,25)11-7-4-3-5-9-13(16,14(17,18)19)15(20,21)22/h3-12H2,1-2H3 |
| InChIKey | FLDFKJQWRVJUND-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|