C18H34F6NO2S+ — CID 58419002
trimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylbutyl]azanium (PubChem CID 58419002) has the molecular formula C18H34F6NO2S+ and a molecular weight of 442.53 g/mol. Its IUPAC name is trimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylbutyl]azanium.
| Compound Name | trimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylbutyl]azanium |
|---|---|
| PubChem CID | 58419002 |
| Molecular Formula | C18H34F6NO2S+ |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | trimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylbutyl]azanium |
| SMILES | CC(C)(CC(CCCCS(=O)(=O)CCCC[N+](C)(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H34F6NO2S/c1-16(2,18(22,23)24)14-15(17(19,20)21)10-6-8-12-28(26,27)13-9-7-11-25(3,4)5/h15H,6-14H2,1-5H3/q+1 |
| InChIKey | OVRICJFCLZADAC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|