C16H26F9NO2S — CID 58419095
4-[3,3,7,8,8,8-hexafluoro-7-methyl-5-(trifluoromethyl)octyl]sulfonyl-N,N-dimethylbutan-1-amine (PubChem CID 58419095) has the molecular formula C16H26F9NO2S and a molecular weight of 467.44 g/mol. Its IUPAC name is 4-[3,3,7,8,8,8-hexafluoro-7-methyl-5-(trifluoromethyl)octyl]sulfonyl-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[3,3,7,8,8,8-hexafluoro-7-methyl-5-(trifluoromethyl)octyl]sulfonyl-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 58419095 |
| Molecular Formula | C16H26F9NO2S |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 4-[3,3,7,8,8,8-hexafluoro-7-methyl-5-(trifluoromethyl)octyl]sulfonyl-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCS(=O)(=O)CCC(F)(F)CC(CC(C)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H26F9NO2S/c1-13(17,16(23,24)25)10-12(15(20,21)22)11-14(18,19)6-9-29(27,28)8-5-4-7-26(2)3/h12H,4-11H2,1-3H3 |
| InChIKey | SGBFUMLUJADUGI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|