C17H32F6NO3S+ — CID 58419048
hydroxy-dimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylbutyl]azanium (PubChem CID 58419048) has the molecular formula C17H32F6NO3S+ and a molecular weight of 444.50 g/mol. Its IUPAC name is hydroxy-dimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylbutyl]azanium.
| Compound Name | hydroxy-dimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylbutyl]azanium |
|---|---|
| PubChem CID | 58419048 |
| Molecular Formula | C17H32F6NO3S+ |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | hydroxy-dimethyl-[4-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylbutyl]azanium |
| SMILES | CC(C)(CC(CCCCS(=O)(=O)CCCC[N+](C)(C)O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H32F6NO3S/c1-15(2,17(21,22)23)13-14(16(18,19)20)9-5-7-11-28(26,27)12-8-6-10-24(3,4)25/h14,25H,5-13H2,1-4H3/q+1 |
| InChIKey | JQPOFWIFORMDID-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|