C15H29F4NO3S — CID 157475981
N,N-dimethyl-4-(7,8,8,8-tetrafluoro-7-methyloctyl)sulfonylbutan-1-amine oxide (PubChem CID 157475981) has the molecular formula C15H29F4NO3S and a molecular weight of 379.46 g/mol. Its IUPAC name is N,N-dimethyl-4-(7,8,8,8-tetrafluoro-7-methyloctyl)sulfonylbutan-1-amine oxide.
| Compound Name | N,N-dimethyl-4-(7,8,8,8-tetrafluoro-7-methyloctyl)sulfonylbutan-1-amine oxide |
|---|---|
| PubChem CID | 157475981 |
| Molecular Formula | C15H29F4NO3S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N,N-dimethyl-4-(7,8,8,8-tetrafluoro-7-methyloctyl)sulfonylbutan-1-amine oxide |
| SMILES | CC(F)(CCCCCCS(=O)(=O)CCCC[N+](C)(C)[O-])C(F)(F)F |
| InChI | InChI=1S/C15H29F4NO3S/c1-14(16,15(17,18)19)10-6-4-5-8-12-24(22,23)13-9-7-11-20(2,3)21/h4-13H2,1-3H3 |
| InChIKey | BVPCLNMZTNKDEQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|