C16H30F6NO3S+ — CID 58419037
hydroxy-dimethyl-[3-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylpropyl]azanium (PubChem CID 58419037) has the molecular formula C16H30F6NO3S+ and a molecular weight of 430.48 g/mol. Its IUPAC name is hydroxy-dimethyl-[3-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylpropyl]azanium.
| Compound Name | hydroxy-dimethyl-[3-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylpropyl]azanium |
|---|---|
| PubChem CID | 58419037 |
| Molecular Formula | C16H30F6NO3S+ |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | hydroxy-dimethyl-[3-[8,8,8-trifluoro-7,7-dimethyl-5-(trifluoromethyl)octyl]sulfonylpropyl]azanium |
| SMILES | CC(C)(CC(CCCCS(=O)(=O)CCC[N+](C)(C)O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H30F6NO3S/c1-14(2,16(20,21)22)12-13(15(17,18)19)8-5-6-10-27(25,26)11-7-9-23(3,4)24/h13,24H,5-12H2,1-4H3/q+1 |
| InChIKey | GFIUGBGARBYJQZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|