C12H21F7NO3S+ — CID 123686095
hydroxy-dimethyl-[4-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylbutyl]azanium (PubChem CID 123686095) has the molecular formula C12H21F7NO3S+ and a molecular weight of 392.36 g/mol. Its IUPAC name is hydroxy-dimethyl-[4-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylbutyl]azanium.
| Compound Name | hydroxy-dimethyl-[4-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylbutyl]azanium |
|---|---|
| PubChem CID | 123686095 |
| Molecular Formula | C12H21F7NO3S+ |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | hydroxy-dimethyl-[4-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylbutyl]azanium |
| SMILES | C[N+](C)(O)CCCCS(=O)(=O)CCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H21F7NO3S/c1-20(2,21)7-3-4-8-24(22,23)9-5-6-10(13,11(14,15)16)12(17,18)19/h21H,3-9H2,1-2H3/q+1 |
| InChIKey | FHDRLXZRRZSWFW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|