C12H27FNO2S+ — CID 158715572
4-(3-fluoro-3-methylbutyl)sulfonylbutyl-trimethylazanium (PubChem CID 158715572) has the molecular formula C12H27FNO2S+ and a molecular weight of 268.42 g/mol. Its IUPAC name is 4-(3-fluoro-3-methylbutyl)sulfonylbutyl-trimethylazanium.
| Compound Name | 4-(3-fluoro-3-methylbutyl)sulfonylbutyl-trimethylazanium |
|---|---|
| PubChem CID | 158715572 |
| Molecular Formula | C12H27FNO2S+ |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-(3-fluoro-3-methylbutyl)sulfonylbutyl-trimethylazanium |
| SMILES | CC(C)(F)CCS(=O)(=O)CCCC[N+](C)(C)C |
| InChI | InChI=1S/C12H27FNO2S/c1-12(2,13)8-11-17(15,16)10-7-6-9-14(3,4)5/h6-11H2,1-5H3/q+1 |
| InChIKey | IYLYEKKSYZTNOO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|