C18H23N3O3 — CID 100644801
N-[(2R)-3-hydroxy-2-[(3S)-oxolan-3-yl]propyl]-2-imidazol-1-yl-5-methylbenzamide (PubChem CID 100644801) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[(2R)-3-hydroxy-2-[(3S)-oxolan-3-yl]propyl]-2-imidazol-1-yl-5-methylbenzamide.
| Compound Name | N-[(2R)-3-hydroxy-2-[(3S)-oxolan-3-yl]propyl]-2-imidazol-1-yl-5-methylbenzamide |
|---|---|
| PubChem CID | 100644801 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[(2R)-3-hydroxy-2-[(3S)-oxolan-3-yl]propyl]-2-imidazol-1-yl-5-methylbenzamide |
| SMILES | Cc1ccc(-n2ccnc2)c(C(=O)NC[C@H](CO)[C@@H]2CCOC2)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-13-2-3-17(21-6-5-19-12-21)16(8-13)18(23)20-9-15(10-22)14-4-7-24-11-14/h2-3,5-6,8,12,14-15,22H,4,7,9-11H2,1H3,(H,20,23)/t14-,15-/m1/s1 |
| InChIKey | DIHUFOLOKBGIAJ-HUUCEWRRSA-N |
| XLogP | 1.56 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |