C19H18FN3O2 — CID 111566196
N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-imidazol-1-yl-5-methylbenzamide (PubChem CID 111566196) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-imidazol-1-yl-5-methylbenzamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-imidazol-1-yl-5-methylbenzamide |
|---|---|
| PubChem CID | 111566196 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-imidazol-1-yl-5-methylbenzamide |
| SMILES | Cc1ccc(-n2ccnc2)c(C(=O)NCC(O)c2ccccc2F)c1 |
| InChI | InChI=1S/C19H18FN3O2/c1-13-6-7-17(23-9-8-21-12-23)15(10-13)19(25)22-11-18(24)14-4-2-3-5-16(14)20/h2-10,12,18,24H,11H2,1H3,(H,22,25) |
| InChIKey | MUFBHFNUEHELMB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |