C18H15F2N3O2 — CID 111451547
N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-imidazol-1-ylbenzamide (PubChem CID 111451547) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-imidazol-1-ylbenzamide.
| Compound Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-imidazol-1-ylbenzamide |
|---|---|
| PubChem CID | 111451547 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-imidazol-1-ylbenzamide |
| SMILES | O=C(NCC(O)c1c(F)cccc1F)c1cccc(-n2ccnc2)c1 |
| InChI | InChI=1S/C18H15F2N3O2/c19-14-5-2-6-15(20)17(14)16(24)10-22-18(25)12-3-1-4-13(9-12)23-8-7-21-11-23/h1-9,11,16,24H,10H2,(H,22,25) |
| InChIKey | CYPZTUSIOCGLCK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |