C21H30N4O3 — CID 86956646
tert-butyl N-[1-[(2-imidazol-1-yl-5-methylbenzoyl)amino]-3-methylbutan-2-yl]carbamate (PubChem CID 86956646) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-imidazol-1-yl-5-methylbenzoyl)amino]-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-imidazol-1-yl-5-methylbenzoyl)amino]-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86956646 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | tert-butyl N-[1-[(2-imidazol-1-yl-5-methylbenzoyl)amino]-3-methylbutan-2-yl]carbamate |
| SMILES | Cc1ccc(-n2ccnc2)c(C(=O)NCC(NC(=O)OC(C)(C)C)C(C)C)c1 |
| InChI | InChI=1S/C21H30N4O3/c1-14(2)17(24-20(27)28-21(4,5)6)12-23-19(26)16-11-15(3)7-8-18(16)25-10-9-22-13-25/h7-11,13-14,17H,12H2,1-6H3,(H,23,26)(H,24,27) |
| InChIKey | DKRJBSCAQNGFMY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |