C19H30N2O3S — CID 86956632
tert-butyl N-[3-methyl-1-(2-phenylsulfanylpropanoylamino)butan-2-yl]carbamate (PubChem CID 86956632) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-(2-phenylsulfanylpropanoylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-(2-phenylsulfanylpropanoylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 86956632 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | tert-butyl N-[3-methyl-1-(2-phenylsulfanylpropanoylamino)butan-2-yl]carbamate |
| SMILES | CC(Sc1ccccc1)C(=O)NCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H30N2O3S/c1-13(2)16(21-18(23)24-19(4,5)6)12-20-17(22)14(3)25-15-10-8-7-9-11-15/h7-11,13-14,16H,12H2,1-6H3,(H,20,22)(H,21,23) |
| InChIKey | LTIITWNMLNGZPN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |