C18H26F2N2O3S — CID 86956683
tert-butyl N-[1-[[4-(difluoromethylsulfanyl)benzoyl]amino]-3-methylbutan-2-yl]carbamate (PubChem CID 86956683) has the molecular formula C18H26F2N2O3S and a molecular weight of 388.48 g/mol. Its IUPAC name is tert-butyl N-[1-[[4-(difluoromethylsulfanyl)benzoyl]amino]-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[4-(difluoromethylsulfanyl)benzoyl]amino]-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86956683 |
| Molecular Formula | C18H26F2N2O3S |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | tert-butyl N-[1-[[4-(difluoromethylsulfanyl)benzoyl]amino]-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)C(CNC(=O)c1ccc(SC(F)F)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26F2N2O3S/c1-11(2)14(22-17(24)25-18(3,4)5)10-21-15(23)12-6-8-13(9-7-12)26-16(19)20/h6-9,11,14,16H,10H2,1-5H3,(H,21,23)(H,22,24) |
| InChIKey | KBMRQIPIYZVJFU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |