C14H17NO5S2 — CID 100645289
methyl 5-[[(1R,6R)-6-methylcyclohex-3-ene-1-carbonyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 100645289) has the molecular formula C14H17NO5S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is methyl 5-[[(1R,6R)-6-methylcyclohex-3-ene-1-carbonyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[(1R,6R)-6-methylcyclohex-3-ene-1-carbonyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 100645289 |
| Molecular Formula | C14H17NO5S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | methyl 5-[[(1R,6R)-6-methylcyclohex-3-ene-1-carbonyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC(=O)[C@@H]2CC=CC[C@H]2C)s1 |
| InChI | InChI=1S/C14H17NO5S2/c1-9-5-3-4-6-10(9)13(16)15-22(18,19)12-8-7-11(21-12)14(17)20-2/h3-4,7-10H,5-6H2,1-2H3,(H,15,16)/t9-,10-/m1/s1 |
| InChIKey | APOHELWMSMIDTQ-NXEZZACHSA-N |
| XLogP | 1.94 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|