C10H13NO5S2 — CID 167188486
methyl 5-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 167188486) has the molecular formula C10H13NO5S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 5-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 5-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 167188486 |
| Molecular Formula | C10H13NO5S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | methyl 5-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CC[C@H](O)C2)s1 |
| InChI | InChI=1S/C10H13NO5S2/c1-16-10(13)8-2-3-9(17-8)18(14,15)11-5-4-7(12)6-11/h2-3,7,12H,4-6H2,1H3/t7-/m0/s1 |
| InChIKey | SUFHCAFMMXGXGJ-ZETCQYMHSA-N |
| XLogP | 0.29 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |