C13H13N3O8S4 — CID 54552349
methyl 5-[[N'-(5-methoxycarbonylthiophen-2-yl)sulfonylcarbamimidoyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 54552349) has the molecular formula C13H13N3O8S4 and a molecular weight of 467.53 g/mol. Its IUPAC name is methyl 5-[[N'-(5-methoxycarbonylthiophen-2-yl)sulfonylcarbamimidoyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[N'-(5-methoxycarbonylthiophen-2-yl)sulfonylcarbamimidoyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 54552349 |
| Molecular Formula | C13H13N3O8S4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | methyl 5-[[N'-(5-methoxycarbonylthiophen-2-yl)sulfonylcarbamimidoyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N=C(N)NS(=O)(=O)c2ccc(C(=O)OC)s2)s1 |
| InChI | InChI=1S/C13H13N3O8S4/c1-23-11(17)7-3-5-9(25-7)27(19,20)15-13(14)16-28(21,22)10-6-4-8(26-10)12(18)24-2/h3-6H,1-2H3,(H3,14,15,16) |
| InChIKey | ZKTWPARWUWRORV-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|