C16H15Cl2N3O — CID 100647091
5-amino-N-cyclopropyl-2-(2,3-dichloroanilino)benzamide (PubChem CID 100647091) has the molecular formula C16H15Cl2N3O and a molecular weight of 336.22 g/mol. Its IUPAC name is 5-amino-N-cyclopropyl-2-(2,3-dichloroanilino)benzamide.
| Compound Name | 5-amino-N-cyclopropyl-2-(2,3-dichloroanilino)benzamide |
|---|---|
| PubChem CID | 100647091 |
| Molecular Formula | C16H15Cl2N3O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 5-amino-N-cyclopropyl-2-(2,3-dichloroanilino)benzamide |
| SMILES | Nc1ccc(Nc2cccc(Cl)c2Cl)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C16H15Cl2N3O/c17-12-2-1-3-14(15(12)18)21-13-7-4-9(19)8-11(13)16(22)20-10-5-6-10/h1-4,7-8,10,21H,5-6,19H2,(H,20,22) |
| InChIKey | JSDZRHFTWFKJPX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|