C29H33FIN3O4S — CID 100647270
(2S)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100647270) has the molecular formula C29H33FIN3O4S and a molecular weight of 665.57 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100647270 |
| Molecular Formula | C29H33FIN3O4S |
| Molecular Weight | 665.57 g/mol |
| Exact Mass | 665.12 |
| IUPAC Name | (2S)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C29H33FIN3O4S/c1-3-4-18-32-29(36)27(19-22-10-6-5-7-11-22)33(20-23-12-8-9-13-26(23)30)28(35)21-34(39(2,37)38)25-16-14-24(31)15-17-25/h5-17,27H,3-4,18-21H2,1-2H3,(H,32,36)/t27-/m0/s1 |
| InChIKey | UKWFBSWSEVSOFA-MHZLTWQESA-N |
| XLogP | 4.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|