C12H13ClF3N3O2 — CID 100647448
(3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-hydroxypiperidine-3-carboxamide (PubChem CID 100647448) has the molecular formula C12H13ClF3N3O2 and a molecular weight of 323.70 g/mol. Its IUPAC name is (3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-hydroxypiperidine-3-carboxamide.
| Compound Name | (3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-hydroxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 100647448 |
| Molecular Formula | C12H13ClF3N3O2 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-hydroxypiperidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(O)CCCN(c2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C12H13ClF3N3O2/c13-8-4-7(12(14,15)16)5-18-9(8)19-3-1-2-11(21,6-19)10(17)20/h4-5,21H,1-3,6H2,(H2,17,20)/t11-/m0/s1 |
| InChIKey | NXSSFRRQZPZXQN-NSHDSACASA-N |
| XLogP | 1.57 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |