C14H18N4OS2 — CID 10064747
N-[[methyl(2-methylprop-2-enylcarbamothioyl)amino]carbamothioyl]benzamide (PubChem CID 10064747) has the molecular formula C14H18N4OS2 and a molecular weight of 322.46 g/mol. Its IUPAC name is N-[[methyl(2-methylprop-2-enylcarbamothioyl)amino]carbamothioyl]benzamide.
| Compound Name | N-[[methyl(2-methylprop-2-enylcarbamothioyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 10064747 |
| Molecular Formula | C14H18N4OS2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[[methyl(2-methylprop-2-enylcarbamothioyl)amino]carbamothioyl]benzamide |
| SMILES | C=C(C)CNC(=S)N(C)NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18N4OS2/c1-10(2)9-15-14(21)18(3)17-13(20)16-12(19)11-7-5-4-6-8-11/h4-8H,1,9H2,2-3H3,(H,15,21)(H2,16,17,19,20) |
| InChIKey | UXQXLXNYTKQLDG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|