C24H35N5O2S — CID 100648176
1-[4-hydroxy-4-[2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,3-thiazol-4-yl]piperidin-1-yl]hexan-1-one (PubChem CID 100648176) has the molecular formula C24H35N5O2S and a molecular weight of 457.64 g/mol. Its IUPAC name is 1-[4-hydroxy-4-[2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,3-thiazol-4-yl]piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[4-hydroxy-4-[2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,3-thiazol-4-yl]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 100648176 |
| Molecular Formula | C24H35N5O2S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 1-[4-hydroxy-4-[2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1,3-thiazol-4-yl]piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC(O)(c2csc(CN3CCN(c4ccccn4)CC3)n2)CC1 |
| InChI | InChI=1S/C24H35N5O2S/c1-2-3-4-8-23(30)29-12-9-24(31,10-13-29)20-19-32-22(26-20)18-27-14-16-28(17-15-27)21-7-5-6-11-25-21/h5-7,11,19,31H,2-4,8-10,12-18H2,1H3 |
| InChIKey | CZHDECLFKUAWSQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|