C20H22N2O4 — CID 100648196
[3-nitro-4-[(3R)-2,2,3-trimethylmorpholin-4-yl]phenyl]-phenylmethanone (PubChem CID 100648196) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [3-nitro-4-[(3R)-2,2,3-trimethylmorpholin-4-yl]phenyl]-phenylmethanone.
| Compound Name | [3-nitro-4-[(3R)-2,2,3-trimethylmorpholin-4-yl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 100648196 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [3-nitro-4-[(3R)-2,2,3-trimethylmorpholin-4-yl]phenyl]-phenylmethanone |
| SMILES | C[C@H]1N(c2ccc(C(=O)c3ccccc3)cc2[N+](=O)[O-])CCOC1(C)C |
| InChI | InChI=1S/C20H22N2O4/c1-14-20(2,3)26-12-11-21(14)17-10-9-16(13-18(17)22(24)25)19(23)15-7-5-4-6-8-15/h4-10,13-14H,11-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | FCZFLGRICSHOEU-CQSZACIVSA-N |
| XLogP | 3.83 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|