C16H12N4S2 — CID 10064850
4-phenyl-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)imidazol-2-amine (PubChem CID 10064850) has the molecular formula C16H12N4S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-phenyl-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)imidazol-2-amine.
| Compound Name | 4-phenyl-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 10064850 |
| Molecular Formula | C16H12N4S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 4-phenyl-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)imidazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2)cn1-c1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C16H12N4S2/c17-15-18-12(11-5-2-1-3-6-11)9-20(15)16-19-13(10-22-16)14-7-4-8-21-14/h1-10H,(H2,17,18) |
| InChIKey | BAVAMKJQOXHMRJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |