C18H32N2O5 — CID 100667750
tert-butyl (3S)-3-[(3-ethoxy-1-hydroxycyclobutyl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 100667750) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(3-ethoxy-1-hydroxycyclobutyl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(3-ethoxy-1-hydroxycyclobutyl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 100667750 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | tert-butyl (3S)-3-[(3-ethoxy-1-hydroxycyclobutyl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC1CC(O)(CNC(=O)[C@H]2CCCN(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C18H32N2O5/c1-5-24-14-9-18(23,10-14)12-19-15(21)13-7-6-8-20(11-13)16(22)25-17(2,3)4/h13-14,23H,5-12H2,1-4H3,(H,19,21)/t13-,14?,18?/m0/s1 |
| InChIKey | ITAILEPRRPXGGD-VNSJNIRKSA-N |
| XLogP | 1.68 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |