C15H18ClN3O2S — CID 100667905
4-[(2S)-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-1,5-dimethylpyrazole (PubChem CID 100667905) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 4-[(2S)-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-1,5-dimethylpyrazole.
| Compound Name | 4-[(2S)-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-1,5-dimethylpyrazole |
|---|---|
| PubChem CID | 100667905 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[(2S)-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-1,5-dimethylpyrazole |
| SMILES | Cc1c([C@@H]2CCCN2S(=O)(=O)c2ccc(Cl)cc2)cnn1C |
| InChI | InChI=1S/C15H18ClN3O2S/c1-11-14(10-17-18(11)2)15-4-3-9-19(15)22(20,21)13-7-5-12(16)6-8-13/h5-8,10,15H,3-4,9H2,1-2H3/t15-/m0/s1 |
| InChIKey | DHEUJIAZAVORQM-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |