C14H16ClN3O2S — CID 110104553
2-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-5-methyl-1H-imidazole (PubChem CID 110104553) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-5-methyl-1H-imidazole.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 110104553 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-5-methyl-1H-imidazole |
| SMILES | Cc1cnc(C2CCCN2S(=O)(=O)c2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-10-9-16-14(17-10)13-3-2-8-18(13)21(19,20)12-6-4-11(15)5-7-12/h4-7,9,13H,2-3,8H2,1H3,(H,16,17) |
| InChIKey | KJEVJEJGJLEWBP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |