C19H27NO4 — CID 100668034
(2R)-1-[benzyl-[(2S)-2-(furan-2-yl)-2-hydroxyethyl]amino]-4-ethoxybutan-2-ol (PubChem CID 100668034) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R)-1-[benzyl-[(2S)-2-(furan-2-yl)-2-hydroxyethyl]amino]-4-ethoxybutan-2-ol.
| Compound Name | (2R)-1-[benzyl-[(2S)-2-(furan-2-yl)-2-hydroxyethyl]amino]-4-ethoxybutan-2-ol |
|---|---|
| PubChem CID | 100668034 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2R)-1-[benzyl-[(2S)-2-(furan-2-yl)-2-hydroxyethyl]amino]-4-ethoxybutan-2-ol |
| SMILES | CCOCC[C@@H](O)CN(Cc1ccccc1)C[C@H](O)c1ccco1 |
| InChI | InChI=1S/C19H27NO4/c1-2-23-12-10-17(21)14-20(13-16-7-4-3-5-8-16)15-18(22)19-9-6-11-24-19/h3-9,11,17-18,21-22H,2,10,12-15H2,1H3/t17-,18+/m1/s1 |
| InChIKey | SAJCFSUEMFGLOG-MSOLQXFVSA-N |
| XLogP | 2.60 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|