C21H26ClFN2O4S2 — CID 100671561
N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 100671561) has the molecular formula C21H26ClFN2O4S2 and a molecular weight of 489.03 g/mol. Its IUPAC name is N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100671561 |
| Molecular Formula | C21H26ClFN2O4S2 |
| Molecular Weight | 489.03 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-4-(3-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | COc1cccc(N(CCCC(=O)NCCSCc2c(F)cccc2Cl)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H26ClFN2O4S2/c1-29-17-7-3-6-16(14-17)25(31(2,27)28)12-5-10-21(26)24-11-13-30-15-18-19(22)8-4-9-20(18)23/h3-4,6-9,14H,5,10-13,15H2,1-2H3,(H,24,26) |
| InChIKey | LVIHLINEDVDRPG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.03 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|