C20H24ClFN2O3S2 — CID 21367262
N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide (PubChem CID 21367262) has the molecular formula C20H24ClFN2O3S2 and a molecular weight of 459.01 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 21367262 |
| Molecular Formula | C20H24ClFN2O3S2 |
| Molecular Weight | 459.01 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)NCCSCc1ccccc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24ClFN2O3S2/c1-29(26,27)24(18-10-8-17(22)9-11-18)13-4-7-20(25)23-12-14-28-15-16-5-2-3-6-19(16)21/h2-3,5-6,8-11H,4,7,12-15H2,1H3,(H,23,25) |
| InChIKey | XEHSUWGQROCDPM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.01 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|