C22H28Cl2N2O3S2 — CID 100537167
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(3,5-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 100537167) has the molecular formula C22H28Cl2N2O3S2 and a molecular weight of 503.52 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(3,5-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(3,5-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100537167 |
| Molecular Formula | C22H28Cl2N2O3S2 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-4-(3,5-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | Cc1cc(C)cc(N(CCCC(=O)NCCSCc2ccc(Cl)c(Cl)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H28Cl2N2O3S2/c1-16-11-17(2)13-19(12-16)26(31(3,28)29)9-4-5-22(27)25-8-10-30-15-18-6-7-20(23)21(24)14-18/h6-7,11-14H,4-5,8-10,15H2,1-3H3,(H,25,27) |
| InChIKey | ASBYBLSGEXDHOT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|