C14H25BrN2O2S — CID 10067386
tert-butyl N-[(1S,2S)-2-methyl-1-(4-methyl-5H-1,3-thiazol-1-ium-2-yl)butyl]carbamate bromide (PubChem CID 10067386) has the molecular formula C14H25BrN2O2S and a molecular weight of 365.34 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-methyl-1-(4-methyl-5H-1,3-thiazol-1-ium-2-yl)butyl]carbamate bromide.
| Compound Name | tert-butyl N-[(1S,2S)-2-methyl-1-(4-methyl-5H-1,3-thiazol-1-ium-2-yl)butyl]carbamate bromide |
|---|---|
| PubChem CID | 10067386 |
| Molecular Formula | C14H25BrN2O2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-methyl-1-(4-methyl-5H-1,3-thiazol-1-ium-2-yl)butyl]carbamate bromide |
| SMILES | CC[C@H](C)[C@H](NC(=O)OC(C)(C)C)C1=[S+]CC(C)=N1.[Br-] |
| InChI | InChI=1S/C14H24N2O2S.BrH/c1-7-9(2)11(12-15-10(3)8-19-12)16-13(17)18-14(4,5)6;/h9,11H,7-8H2,1-6H3;1H/t9-,11-;/m0./s1 |
| InChIKey | DYPYGCHWLLTBGQ-ROLPUNSJSA-N |
| XLogP | -0.38 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|