C18H22O8 — CID 10067527
[(2R,3R,4R,6S)-3,4-diacetyloxy-5-deuterio-6-phenoxyoxan-2-yl]methyl acetate (PubChem CID 10067527) has the molecular formula C18H22O8 and a molecular weight of 367.37 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-3,4-diacetyloxy-5-deuterio-6-phenoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-5-deuterio-6-phenoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10067527 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-5-deuterio-6-phenoxyoxan-2-yl]methyl acetate |
| SMILES | [2H]C1[C@H](Oc2ccccc2)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H22O8/c1-11(19)22-10-16-18(24-13(3)21)15(23-12(2)20)9-17(26-16)25-14-7-5-4-6-8-14/h4-8,15-18H,9-10H2,1-3H3/t15-,16-,17-,18-/m1/s1/i9D/t9?,15-,16-,17-,18- |
| InChIKey | ZLNOUVXLATXOGX-UEUIXVLRSA-N |
| XLogP | 1.61 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|