C14H22O8 — CID 10064530
[(2R,3S,4R,6S)-3,4-diacetyloxy-5-deuterio-6-ethoxyoxan-2-yl]methyl acetate (PubChem CID 10064530) has the molecular formula C14H22O8 and a molecular weight of 319.33 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-3,4-diacetyloxy-5-deuterio-6-ethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6S)-3,4-diacetyloxy-5-deuterio-6-ethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10064530 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [(2R,3S,4R,6S)-3,4-diacetyloxy-5-deuterio-6-ethoxyoxan-2-yl]methyl acetate |
| SMILES | [2H]C1[C@@H](OCC)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H22O8/c1-5-18-13-6-11(20-9(3)16)14(21-10(4)17)12(22-13)7-19-8(2)15/h11-14H,5-7H2,1-4H3/t11-,12-,13+,14+/m1/s1/i6D/t6?,11-,12-,13+,14+ |
| InChIKey | FYRWMXQGVDQCTF-RRFKWPFISA-N |
| XLogP | 0.56 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|