C23H35N3O4 — CID 100675921
(2R)-2-methyl-2-[[1-[(3-methylphenyl)carbamoyl]piperidine-4-carbonyl]amino]octanoic acid (PubChem CID 100675921) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is (2R)-2-methyl-2-[[1-[(3-methylphenyl)carbamoyl]piperidine-4-carbonyl]amino]octanoic acid.
| Compound Name | (2R)-2-methyl-2-[[1-[(3-methylphenyl)carbamoyl]piperidine-4-carbonyl]amino]octanoic acid |
|---|---|
| PubChem CID | 100675921 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | (2R)-2-methyl-2-[[1-[(3-methylphenyl)carbamoyl]piperidine-4-carbonyl]amino]octanoic acid |
| SMILES | CCCCCC[C@@](C)(NC(=O)C1CCN(C(=O)Nc2cccc(C)c2)CC1)C(=O)O |
| InChI | InChI=1S/C23H35N3O4/c1-4-5-6-7-13-23(3,21(28)29)25-20(27)18-11-14-26(15-12-18)22(30)24-19-10-8-9-17(2)16-19/h8-10,16,18H,4-7,11-15H2,1-3H3,(H,24,30)(H,25,27)(H,28,29)/t23-/m1/s1 |
| InChIKey | QDWKZZGSWOBHAL-HSZRJFAPSA-N |
| XLogP | 4.17 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|