C17H20N4O2S — CID 100676612
5-[(2R)-1-(2-methylsulfanylbenzoyl)piperidin-2-yl]-1H-pyrazole-3-carboxamide (PubChem CID 100676612) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 5-[(2R)-1-(2-methylsulfanylbenzoyl)piperidin-2-yl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-[(2R)-1-(2-methylsulfanylbenzoyl)piperidin-2-yl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 100676612 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5-[(2R)-1-(2-methylsulfanylbenzoyl)piperidin-2-yl]-1H-pyrazole-3-carboxamide |
| SMILES | CSc1ccccc1C(=O)N1CCCC[C@@H]1c1cc(C(N)=O)n[nH]1 |
| InChI | InChI=1S/C17H20N4O2S/c1-24-15-8-3-2-6-11(15)17(23)21-9-5-4-7-14(21)12-10-13(16(18)22)20-19-12/h2-3,6,8,10,14H,4-5,7,9H2,1H3,(H2,18,22)(H,19,20)/t14-/m1/s1 |
| InChIKey | LYOSMNJKEODILO-CQSZACIVSA-N |
| XLogP | 2.60 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |