C17H23Cl2NO4 — CID 100680321
2-(3,4-dichlorophenyl)-1-[(3R,5S)-3-(hydroxymethyl)-5-(2-methoxyethoxy)piperidin-1-yl]ethanone (PubChem CID 100680321) has the molecular formula C17H23Cl2NO4 and a molecular weight of 376.28 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[(3R,5S)-3-(hydroxymethyl)-5-(2-methoxyethoxy)piperidin-1-yl]ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[(3R,5S)-3-(hydroxymethyl)-5-(2-methoxyethoxy)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 100680321 |
| Molecular Formula | C17H23Cl2NO4 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[(3R,5S)-3-(hydroxymethyl)-5-(2-methoxyethoxy)piperidin-1-yl]ethanone |
| SMILES | COCCO[C@H]1C[C@@H](CO)CN(C(=O)Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H23Cl2NO4/c1-23-4-5-24-14-6-13(11-21)9-20(10-14)17(22)8-12-2-3-15(18)16(19)7-12/h2-3,7,13-14,21H,4-6,8-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | QNPCTFSQDSVJDN-KGLIPLIRSA-N |
| XLogP | 2.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|