C13H15Cl2NO3 — CID 71979962
(2,5-dichlorophenyl)-[3-(2-methoxyethoxy)azetidin-1-yl]methanone (PubChem CID 71979962) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-[3-(2-methoxyethoxy)azetidin-1-yl]methanone.
| Compound Name | (2,5-dichlorophenyl)-[3-(2-methoxyethoxy)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 71979962 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | (2,5-dichlorophenyl)-[3-(2-methoxyethoxy)azetidin-1-yl]methanone |
| SMILES | COCCOC1CN(C(=O)c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C13H15Cl2NO3/c1-18-4-5-19-10-7-16(8-10)13(17)11-6-9(14)2-3-12(11)15/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | MUOHLYMHPLXSBD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|