C19H26N2O6 — CID 10068224
tert-butyl N-[(1S)-1-[(4R)-3-(4-methoxyphenyl)-2,5-dioxo-1,3-oxazolidin-4-yl]-2-methylpropyl]carbamate (PubChem CID 10068224) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(4R)-3-(4-methoxyphenyl)-2,5-dioxo-1,3-oxazolidin-4-yl]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(4R)-3-(4-methoxyphenyl)-2,5-dioxo-1,3-oxazolidin-4-yl]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 10068224 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(4R)-3-(4-methoxyphenyl)-2,5-dioxo-1,3-oxazolidin-4-yl]-2-methylpropyl]carbamate |
| SMILES | COc1ccc(N2C(=O)OC(=O)[C@H]2[C@@H](NC(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O6/c1-11(2)14(20-17(23)27-19(3,4)5)15-16(22)26-18(24)21(15)12-7-9-13(25-6)10-8-12/h7-11,14-15H,1-6H3,(H,20,23)/t14-,15+/m0/s1 |
| InChIKey | LTMUDIVJSKVZDE-LSDHHAIUSA-N |
| XLogP | 3.10 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|