About 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile
3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile (PubChem CID 100684977) has the molecular formula C15H17FN2O
and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile |
| PubChem CID | 100684977 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile |
| SMILES | CN(Cc1cc(C#N)ccc1F)C[C@@H]1CCC=CO1 |
| InChI | InChI=1S/C15H17FN2O/c1-18(11-14-4-2-3-7-19-14)10-13-8-12(9-17)5-6-15(13)16/h3,5-8,14H,2,4,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | GYJSLYAZBBWDIG-AWEZNQCLSA-N |
| XLogP | 2.82 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile?
The IUPAC name of 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile (CID 100684977) is 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile.
What is the SMILES notation for 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile?
The canonical SMILES for 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile is CN(Cc1cc(C#N)ccc1F)C[C@@H]1CCC=CO1.
What is the InChIKey of 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile?
The InChIKey is GYJSLYAZBBWDIG-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H17FN2O/c1-18(11-14-4-2-3-7-19-14)10-13-8-12(9-17)5-6-15(13)16/h3,5-8,14H,2,4,10-11H2,1H3/t14-/m0/s1.
What are the key properties of 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile?
3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile has a molecular weight of 260.31 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[[(2S)-3,4-dihydro-2H-pyran-2-yl]methyl-methylamino]methyl]-4-fluorobenzonitrile is sourced from PubChem (CID 100684977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).