C17H21FN2 — CID 63682953
3-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]-4-fluorobenzonitrile (PubChem CID 63682953) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]-4-fluorobenzonitrile.
| Compound Name | 3-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 63682953 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]-4-fluorobenzonitrile |
| SMILES | CN(Cc1cc(C#N)ccc1F)CC1CC2CCC1C2 |
| InChI | InChI=1S/C17H21FN2/c1-20(10-15-7-12-2-4-14(15)6-12)11-16-8-13(9-19)3-5-17(16)18/h3,5,8,12,14-15H,2,4,6-7,10-11H2,1H3 |
| InChIKey | FVUWWIZCLCXGAD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |