C16H23BFNO2 — CID 63681815
[2-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]-5-fluorophenyl]boronic acid (PubChem CID 63681815) has the molecular formula C16H23BFNO2 and a molecular weight of 291.17 g/mol. Its IUPAC name is [2-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]-5-fluorophenyl]boronic acid.
| Compound Name | [2-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]-5-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 63681815 |
| Molecular Formula | C16H23BFNO2 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [2-[[2-bicyclo[2.2.1]heptanylmethyl(methyl)amino]methyl]-5-fluorophenyl]boronic acid |
| SMILES | CN(Cc1ccc(F)cc1B(O)O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C16H23BFNO2/c1-19(10-14-7-11-2-3-12(14)6-11)9-13-4-5-15(18)8-16(13)17(20)21/h4-5,8,11-12,14,20-21H,2-3,6-7,9-10H2,1H3 |
| InChIKey | GJJZBCAJNIPNCD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|